Vous êtes sur la page 1sur 55

ALSCO

Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass U60 U60 U60

Chemical Resistance Guide


F C CR * ABS PVC PE + 0 PP 0 -

Acetaldehyde CH3 -CHO

21C 70F

technically pure

Acetaldehyde

40% aqueous solution

Acetic acid (ESC) CH3COOH

118C 245F

Acetic acid (ESC)

Acetic acid (ESC)

Acetic acid (ESC)

118C 244F

Acetic acid (ESC) CH3COOH

Acetic acid anhydride (ESC) (CH3-CO)2O

139C 282F

O C S L A
technically pure, glacial 50%, aqueous + + 0 + + + + + + + + + + 0 0 + 0 0 0 10%, aqueous + + 0 + + + + + + 0 + + + + + + + + + + + + + + + + 0 0 + 0 + + 0 0 + + + 0 98% + + + + + 60% + 0 + 0 0 + technically pure technically pure technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + 0 0 0

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ 0 -

0 -

0 -

E150 G200

E- G- U- G- E- E150 350 60 120 140 300 G200

0 -

+ + 0

+ + + 0

+ + + +

+ + 0 -

+ + 0 -

+ + + +

0 -

+ + 0

+ + 0 -

+ 0 -

E80 G200 U220 G160 S200

E- E400 80 G200 U220 E- G380 130 S170 U180 E- E- G210 400 120 S160 U170

U- E- E60 560 260

U- E- E60 200 260 G300

U- E- E60 300 260

Acetic Acid isobutyl ester (CH2)2CH-(CH2)2-CO2H

Acetone CH3-CO-CH3

56C 133F

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

413

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + 0 0 + + + ABS PVC PE + + + PP + + +

Acetone

up to 10%, aqueous

Acetonitrile CH3CN

81.6C 100% 179F

Acetophenone CH3-CO-C6H5

Acrylic acid methyl ester 80.3C CH2=CHCOOCH3 176.5F

Acrylic ester CH2=CH-COO CH2CH3

100C 212F

Acrylonitrile CH2=CH-CN

77C

171F

Melting Point Adipic acid HOOC-(CH2)4-COOH 153C 308F

Alcoholic spirits (Gin, Whisky, etc.)

O C S L A
100% + 0 technically pure 0 + technically pure technically pure + + + + 0 + + 0 0 0 0 0 saturated, aqueous + + + + + + + + + + + + + + + + + + + + + + + + + + + + + G- G- G210 210 210 + 0 + + + + + + + + approx 40% ethyl alcohol 96% see Potassium aluminium sulphate 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 0 0 + + + + + + 0 0 0 0 + + + + 0 + + + -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

0 0 0

+ + +

0 0 -

0 0 0

G- G- E- G- G- G- G210 210 210 210 100 200 200

E- E210 450

97C Allyl alcohol 207F

11

Alum

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

414

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass S80

Chemical Resistance Guide


F C CR * + + + ABS PVC PE + + + PP + + +

Aluminium chloride AlCl3

Aluminium chloride AlCl3

Aluminium fluoride AlF3

Aluminium hydroxide Al(OH)3

Aluminium nitrate Al(NO3)3

Aluminium sulphate Al2(SO4)3

Aluminium sulphate

Ammonia (ESC,G) NH3

68 104 10% 140 aqueous 176 212 248 68 104 115C 140 saturated 176 239F 212 248 68 104 140 saturated 176 212 248 68 104 140 Suspension 176 212 248 68 104 140 saturated 176 212 248 68 104 10% 140 aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 -33C gaseous, 140 technically 176 -28F pure 212 248 68 104 140 176 212 248 68 104 140 176 212 248

O C S L A
+ + + + + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 G- G- U210 210 60 + + + + + + + + + + + + + + + + + + + + + + + + + + 0 0 + + + + + + + + + + + 0 0 0 + + 0 + + + E80 E90 Aqueous, all 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + + + + 0 + + + + + + + + + + + + + + + + + + + + + 0 + + + + 0 + + 0 + + -

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + +

+ + + + + + + + + + + + + + + +

+ + + + + + + +

+ + + + + + + + + +

+ + 0

+ + + +

U60

U60

60

U60

U- E60 300

+ + +

+ + + +

+ + +

+ + +

+ + + + 0

+ + + 0 -

+ + + +

+ + + + +

+ + +

U60

U- G- E60 210 80

U- E- E60 100 200

G- G- G- U210 400 350 60

Ammonium acetate CH3COONH4

Ammonium aluminium sulfate

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

415

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + + ABS PVC PE PP + + + + + + + + + +

Ammonium bromide

Ammonium carbonate (NH4)2CO3

50%, aqueous (Metal- Satd)

Ammonium chloride NH4Cl

115C 239F

Ammonium citrate

Ammonium dicromate (NH4)2Cr2O7

Ammonium dihydrogenphosphate

Ammonium fluoride NH4F

Ammonium formiate

O C S L A
aqueous, cold saturated + + + + + + + + saturated + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + 0

+ + + +

+ + +

+ + +

+ + + + + + + + + + + +

+ + + +

+ + + +

+ + +

+ + + +

G- G- G- U- G- G- E210 400 350 60 140 300 210

+ + 0

+ + + +

+ + +

+ + +

+ + + + +

+ + + + + +

+ + +

+ + + +

+ + + + +

Ammonium hexafluorosilicate

11

Ammonium hydrogen carbonate

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

416

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + + 0 + + ABS PVC PE + + + PP + + +

Ammonium hydrogen fluoride NH4HF2 50%, aqueous

Ammonium hydrogen phosphate

Ammonium hydrogen sulfite (NH4)H5

Ammonium hydroxide NH4OH

Ammonium nitrate NH4NO3

112C 234F

Ammonium oxalate H4NOOC-COONH4

Ammonium persulphate (NH4)2S2O8

Ammonium phosphate (NH4)3PO4

O C S L A
aqueous, cold saturated + + 0 + + 0 + + + + + 0 + 0 0 + + 0 aqueous, saturated + + + + + + + + + + + + 0 + + + 0 (Metal - Pure) + + + + + + + + + + + + + + + 0 + + 0 + + + + + + + + + + + + + + + saturated + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + 0 aqueous, saturated aqueous, all (Metal - Pure) 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + 0 + + + + + 0 + + 0 0 0 0 + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + +

+ + +

+ + +

+ + +

+ + + +

+ + + + +

E- E- G- U220 300 350 60

U60

Ammonium sulphate (NH4)2SO4

Ammonium sulphide (NH4)2S

G- G- E- U210 400 100 60 G170 U180

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

417

ALSCO
Chemicals (Medium) and Formulas
Ammonium

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C U60 Titanium E80 S180 Brass U60

Chemical Resistance Guide


F C CR * ABS PVC PE PP 0 0 -

tetrafluoroborate (NH4)BF4

Ammonium thiocyanate NH4SCN

saturated

Amyl acetate CH3(CH2)4-COOCH3

141C 286F

Amyl alcohol (ESC) CH3(CH2)3-CH2-OH

137C 279F

Aniline C6H5NH2

182C 360F

Aniline hydrochloride C6H7N+HCI

245C 473F

Antimony thiocyanate S6SCN

Antimony trichloride (ESC) SbCl3

O C S L A
technically pure technically pure + + 0 + + + + + + + + + + 0 0 technically pure + + + + + 0 + 0 + + + 0 + + + + + + 0 0 0 0 + 0 + + aqueous, saturated + + 0 + + 0 + + + + 0 0 + + + 0 + + + + + 90%, aqueous (Metal - Pure) + + + + + + + + + + + + + + + + U60 U60 U60 80%, aqueous 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + 0 + 0 0 0 U60 U60 U60 + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + G- G- U210 400 60

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + + + + + + +

+ + + +

+ + +

+ 0 0

E- E- E- E- G- E- E300 300 350 400 80 210 210

G- G- G- G80 400 170 80

G- G- G80 100 200

E- E- G- U500 500 350 60

G- G- E90 570 210 U100

U- G60 200

U60

Aqua regia (ESC) HNO3+HCI

11

U- G60 210

Arsenic acid H3AsO4

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

418

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + + + + + + + + + ABS PVC PE + + + PP + + + +

Barium carbonate BaCO3 S

Barium chloride BaCl2

saturated

Barium hydroxide Ba(OH)2

102C 216F

Barium salts

Barium sulfate BaSO4

Barium sulfide BaS

Battery acid see Sulphuric acid 40%

Beef tallow emulsion, sulphonated (ESC)

O C S L A
aqueous, saturated aqueous, all + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + S + + + + + + + + + + + + + suspension + + + + + + + + + + + + + + + + + + + + + + + 0 + + + usual commercial + + + + + + usual commercial saturated, aqueous 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + E- E- E- G210 300 300 80 G80 + + + + + 0 + + + + + + 0 G- G- G- G- U- G- G220 400 80 210 60 200 80

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + +

+ + +

+ +

+ +

+ + +

+ + + +

+ + +

+ + + +

+ + + + + -

+ + +

+ + + +

+ +

+ + 0

+ + + +

+ + +

+ + +

+ + + +

+ + + +

+ + +

+ 0

Beer

Benzaldehyde C6H5-CHO

180C 356F

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

419

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E400 Brass

Chemical Resistance Guide


F C CR * ABS PVC PE 0 0 PP 0 -

Benzene C6H6

80C 176F

technically pure

Benzenesulfonic acid C6H5SO3H

technically pure

Benzine (Gasoline) (ESC) C5H12 to C12H26

80C to 130C 176F to 266F

Benzoic acid C6H5-COOH

Melting Point 122C 252F

Benzyl alcohol (ESC) C6H5-CH2OH

206C 403F

Benzyl chloride C6H5CHCl2

Beryllium chloride BeCl2

Beryllium sulfate BeSO4

O C S L A
free of lead & aromatic compounds aqueous, all + + 0 + + + 0 + + + + + + + + + + + + + + + + 0 0 technically pure + + 0 + + 0 + + 0 + + + + 0 technically pure + + + 0 + + + + + + + + + + + aqueous, all all, aqueous (Metal - Pure) 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 E- E- U150 400 60 + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ 0 -

+ + + + + + + 0 0 + + + + + + + + + + + + -

+ +

+ + +

+ + +

+ + +

+ + +

0 -

G- G- G- G- U400 400 400 210 60

E- E- G- G- G80 410 110 210 80

G- G210 210

G- G- E80 200 100

Borax Na2B4O7

11

E- E- E- U400 400 100 60

U60

E- E560 220

Boric acid H3BO3

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

420

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas
Brine,

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium U60 Brass

Chemical Resistance Guide


F C CR * 0 ABS PVC PE + PP 0

containing chlorine NaClCl2

Bromine, liquid (G) Br2

59C 139F

technically pure

Bromine, vapours Br2

Bromine water (G) Br.H2O

Bromobenzene C6H5Br

Butadiene (Q/E,G) H2C=CH-CH=CH2

-4C

25F

Butane (G) C4H10

0C

32F

Butanediol (ESC) HO-(CH2)4-OH

230C 446F

O C S L A
high + 0 saturated, aqueous + + + + + + + + + + technically pure + + + + + + + + 0 + + 0 + 0 + + + + + + + + + + G- G- G180 300 80 technically pure + 0 + + aqueous, 10% + + + + + + + + + + + + + + + 0 + + + technically pure technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + + + 0 + + + + + 0 + + + + 0 + 0 + + + + 0 + + + + + 0 + + + + 0 + 0 0 0 -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + +

+ + 0

+ + + + 0 + + + + 0

U60

U- G60 210

G- G- G- G180 400 100 80

G80

G- E- G- E80 350 250 80

Butanol (ESC) C4H9OH

117C 243F

Butyl acetate CH3COOCH2CH2CH2CH3

126C 259F

G- G- E- G- G80 370 80 210 80

G- E210 210

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

421

ALSCO
Chemicals (Medium) and Formulas
Butyl phenol, p-tertiary

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * ABS PVC PE 0 PP +

237C 459F

(CH3)3C-C6H4-OH

technically pure

Butylene glycol (ESC) HO-CH2-CH=CH-CH2-OH

235C 455F

technically pure

Butylene liquid C4H8

51C

124F

Butyric acid (ESC) CH3-CH2-CH2-COOH

163C 326F

Cadmium bromide CdBr2

Cadmium chloride CdCl2

Cadmium cyanide Cd(CN)2

Cadmium sulfate CdSO4

O C S L A
technically pure + + technically pure + + 0 + + + + + 0 0 0 0 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 68 104 140 saturated 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

0 -

0 -

+ + + +

G- E- G400 400 80

G200

+ + 0

+ + +

+ + +

+ + +

+ + +

+ + + +

+ + +

+ + 0

+ + +

0 -

Calcium acetate (CH5COO)2Ca

11

Calcium bisulphite Ca(HSO3)2

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

422

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + + 0 + + + ABS PVC PE + + + PP + + + +

Calcium bromide CaBr2

Calcium carbonate CaCO3

Calcium chlorate Ca(ClO3)2

Calcium chloride CaCl2

125C 257F

Calcium fluoride CaF2

Calcium hydrogencarbonate Ca(HCO3)2

Calcium hydrogensulfide Ca(SH)2

Calcium hydrosulfite Ca(HSO3)2

O C S L A
saturated, aqueous, all + + 0 + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + saturated + + + + + 0 saturated, aqueous saturated 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + +

+ + +

+ + +

+ + + +

+ + +

+ + + +

+ + + + + + + +

+ + + +

+ + + +

+ + +

+ + + +

+ + +

+ + +

Calcium hydroxide Ca(OH)2

100C 212F

Calcium lactate (CH3COO)2Ca

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

423

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E220 Brass

Chemical Resistance Guide


F C CR * + + ABS PVC PE + + + PP + + +

Calcium nitrate Ca(NO3)2

115C 50%, aqueous 239F

Calcium phosphate Ca(H2PO4)2 CaHPO4 Ca3(PO4)2

Calcium sulfide Ca5

Calcium sulphate CaSO4

Calcium sulphite Ca(HSO3)2

Calcium tungstate CaO4W

Caprolactam C6H11NO

Caprolactone C6H10O2

O C S L A
suspensions + + + + + + + + + + + + + + + aqueous, cold saturated + + + + + + + + + + + + + + technically, pure anhydrous 46C 115F technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + G- G- E- E- G- E- E200 570 570 570 200 570 80 0 0 + G- G- E- U- G210 400 210 60 180

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ +

+ + + +

+ +

+ + + + + + + + + +

+ + +

+ + + +

+ +

+ + +

G- G350 170

G100

+ + +

+ + + +

Carbon dioxide -carbonic acid (G) CO2

11

Carbon disulphide CS2

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

424

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * ABS PVC PE PP -

Carbon tetrachloride CCl4

77C 171F

technically pure

Carbonic acid H2CO3

Caros acid see Peroxomonosulfuric acid

Casein

Caustic potash solution (potassium hydroxide) KOH

131C 268F

Caustic soda solution NaOH

Cerium (lll) -chloride CeCl3

Cesium chloride ClCs

O C S L A
+ + + 50%, aqueous + + 0 + + + + + + + + + + (Metal - Pure) + + + + + + + + + 0 + 0 + 0 0 G- U150 60 + + 50%, aqueous + + + + + + + 0 + + + 0 + 0 + + + + + + technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + 0 0 0 0 +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

E- E- U- G- G- E- E210 400 60 180 80 120 200 G300

+ + +

+ + + +

+ + +

+ + + +

+ + + + +

+ + + +

+ + + + +

U60

Cesiumhydroxide CsOH

Chloral hydrate CCl3-CH(OH)2

98C 209F

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

425

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass U60 U60

Chemical Resistance Guide


F C CR * ABS PVC PE + + PP -

Chloric acid (ESC) HClO3

10%, aqueous (Metal - 20%)

Chloric acid (ESC) HClO3

20%, aqueous

Chlorine Cl2

Chlorine Cl2

Chlorine Cl2

Chlorine water (ESC,G) Cl2H2O

Chloroacetic acid, mono (ESC) CICH2COOH

Chloroacetic acid, mono (ESC) CICH2COOH

188C 370F

O C S L A
moist, 97%, gasesous (Metal gas, wet) anhydrous, tecnically pure (Metal gas, dry) 0 0 + + + + 0 0 + 0 + 0 liquid, technically pure G120 saturated + + 0 + + 0 0 0 0 0 0 0 0 0 U60 U60 G80 + + 50%, aqueous + + + + + + + 0 0 0 technically pure + + 0 + + + + + + 0 0 technically pure technically] pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 0 + + + 0 0 G200 + + + + + + + 0 0 0 + 0

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + +

+ +

+ + +

+ + +

U60

U60

+ + 0

+ + +

+ +

+ +

U60

U60

U60

U- E- E60 170 400 G220

U- G- G- G- G- G- U60 400 210 570 200 570 60 U220

G- E80 120

U60

E- E200 210

Chlorobenzene C6H5CI

132C 270F

G- G- G- E- G150 210 200 350 190

11

Chloroethanol CICH2-CH2OH

129C 264F

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

426

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass U60

Chemical Resistance Guide


F C CR * ABS PVC PE PP -

Chlorosulphonic acid CISO3H

158C

Chrome alum (chromium potassium sulphate) KCr(SO4)2

Chromic acid (ESC) CrO3H2O

Chromic acid (ESC) CrO3H2O

CrO3 + sulphuric acid H2SO4 + water (ESC) H2O

Chromic acid

Chromium (II) -chloride CrCl3

Chromium (ll) -fluoride CrF3

Chromium (lll) -chloride CrCl3

68 104 140 176 317F (Metal - 100%) 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 up to 50%, 140 aqueous 176 212 248 68 104 140 all, aqueous 176 212 248 68 104 50 g 140 15 g 176 35 g 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 technically pure 68 104 140 176 212 248 68 104 140 176 212 248

O C S L A
0 0 0 0 + + 0 0 0 0 + + 0 + + + 0 + + + 0 0 0 + + + 0 0 + + + + + + + + + + + + + + + + + + + 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon + + +

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

0 -

U60

U60

G80

E- E230 210

+ + +

+ + +

+ +

+ + +

+ + +

+ +

+ + + +

+ + + + + + + +

+ + +

+ + +

+ + +

G- G- U110 110 60

U60

0 0 -

+ 0 0 -

0 -

0 -

+ + + + 0 0 + + + 0 0

0 0 0

0 0 0

Chromium (lll) -nitrate Cr(NO3)3

Chromium (lll) -sulfate Cr(SO4)3

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

427

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C G210 Titanium Brass G210 G80

Chemical Resistance Guide


F C CR * + + + + 0 + 0 + + + + 0 ABS PVC PE + PP +

Cider

Citric acid

Coal gas, benzene free (G)

Coconut fat alcohol (ESC)

Compressed air, containing oil (ESC)

Copper salts CuCl, CuCl2, CuF2 Cu(NO3)2, CuSO4 Cu(CN)2

Corn oil (ESC)

Cresol HO-C6H4-CH3

68 104 140 176 212 248 68 104 Fp., 10%, 140 153C aqueous 176 307F 212 248 68 104 140 176 212 248 68 104 technically 140 pure 176 212 248 68 104 140 176 212 248 68 104 140 all, aqueous 176 212 248 68 104 technically 140 pure 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 102C 216F 68 104 140 176 212 248 68 104 140 176 212 248

O C S L A
+ + 0 + 0 + + 0 + + + + + + + + + + 0 + + 0 + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + 0 0 0 0 0 + + 0 + + 0 + + + + + + + + + + + + 0 0 + + + + + + + 0 + + 0 0 0 E- G- G160 100 140 technically pure technically pure 20 40 60 80 100 120 20 40 60 80 100 120 + + + 0 + + + + + + + + + + + + + + + G- G- G100 400 80

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ +

+ + +

+ + 0

+ + +

+ + +

+ + +

+ + + + + +

+ + + + + +

+ +

+ + +

+ + 0

+ + +

G- G- G- G350 170 80 170

G80

Crotonic aldehyde CH3-CH=CH-CHO

11

Cyclohexane (Q/E) C6H12

81C 178F

G80

G- E80 310

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

428

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C G80 G80 Titanium G80 G80 Brass G80 G80

Chemical Resistance Guide


F C CR * + ABS PVC PE + + + PP + + 0

Cyclohexanol (ESC) C6H12O

161C 322F

technically pure

Cyclohexanone C6H10O

155C 311F

technically pure

Densodrine W

Detergents see washing powder (ESC)

Dextrine (C6H10O5)n

Dextrose

Di isobutyl ketone [(CH3)2CHCH2]2CO

124C 255F

Dibuttyl ether C4H9OC4H9

142C 288F

O C S L A
for usual washing lathers + + 0 0 + + + + + + + + + + + + + + + + + + + + + + + + + E- G180 350 usual commercial + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + G- G400 80 + + + + + + + + + + + technically pure + + 0 0 0 0 technically pure + + 0 + 0 0 0 0 technically pure technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + 0 0 + 0 0 + + 0 0 0 E- G- G- G- G- G- G220 400 300 210 150 200 200 + + + + + -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + 0

+ + 0 0 + 0 -

G80

G80

U80

G80

+ 0 0

+ 0 0

G80

G80

G80

U60

+ + +

+ + +

Dibutyl phthalate C6H4(COOC4H9)2

340C 644F

Dibuty sebacate C8H16(COOC4H9)2

344C 651F

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

429

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E300 Brass

Chemical Resistance Guide


F C CR * 0 + 0 ABS PVC PE + + 0 PP + + 0

Dichloroacetic acid Cl2CHCOOH

194C 381F

technically pure

Dichloroacetic acid (ESC) Cl2CHCOOH

50%, aqueous

Dichloroacetic acid methyl ester Cl2CHCOOCH3

143C 289F

Dichlorobenzene C6H4Cl2

180C 356F

Dichloroethane Ethylene chloride

Dichloroethylene CICH=CHCI

60C

140F

Dichloromethane CH2Cl2

DIesel oil (ESC, Q/E)

O C S L A
technically pure technically pure 0 + + 0 G- G- G210 210 160 technically pure + + + + 0 + 0 0 + + + + + + + + + + 0 0 technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 0 + + + 0 0 G- G- G100 350 80

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + 0 -

+ + +

0 -

+ 0 -

+ + 0

+ + +

+ + +

+ + + 0 0

+ + +

0 0 -

+ + 0

+ + +

+ + +

+ + 0

+ + 0

G- G200 200

G200

Diethyl ether H5C2-O-C2H5

11

Diethylamine (C2H5)2NH

56C 132F

U60

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

430

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + ABS PVC PE + + + PP + + +

Diethylene glycol butyl ether


C4H9-O-(CH2)2-O-(C42)2-O-4

Melting Diglycolic acid (ESC) Point HOOC-CH2-O-CH2-COOH 148C 298F

30%, aqueous

Dimethyl formamide (CH3)2CHNO

153C 307F

Dimethylamine (CH3)2NH

7C

44F

Dimethylphthalate (DMP) C6H4(CH3)2

Dinonyl phthalate (DNP) C6H4((CH2)8CH3)2

Dioctyl phthalate (DOP) (ESC)

Dioxane C4H8O2

101C 214F

O C S L A
technically pure 0 + 0 + 0 0 technically pure 0 + 0 + technically pure 0 + 0 + technically pure technically pure + + + 0 0 0 0 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + +

+ + 0

+ + +

Drinking water see water

Ethanolamine Annino ethanol

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

431

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E220 Brass U60

Chemical Resistance Guide


F C CR * ABS PVC PE + 0 0 PP + 0 0

Ethyl acetate CH3COOC2H5

77C 170F

technically pure

Ethyl alcohol + acetic acid (fermentation mixture)

technically pure

Ethyl alcohol (Ethnoc) (ESC) CH3-CH2-OH

78C

172F

Ethyl benzene C6H5-CH2CH3

136C 277F

Ethyl chloride (G) C2H5Cl

12C 54F

Ethyl ether CH3CH2-O-CH2CH3

35C 95F

Ethylene bromide (1,2-Dibromoethane) Br-C42C42-Br

Ethylene chloride ClCH2-CH2Cl

83C

181F

O C S L A
technically pure, 96% 0 0 0 + technically pure 0 0 0 0 E- E560 560 technically pure + 0 + technically pure 0 0 technically pure + + + 0 0 0 + + 0 0 0 technically pure technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 0 + + + + + + + 0 0 + 0 + 0 0 0 G- G- G80 400 80 + + + 0 + + + + + + + + + + + + + + + + + + + + + 0 + + 0 + + 0 + + + 0

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

G- G220 400

G- G- E200 200 200

+ + 0

+ + +

+ + + 0

0 0

0 0 0

0 0

+ + +

+ + +

+ + 0

+ + +

+ + + +

+ 0 -

+ + +

0 0 0

G- G- E- G- G- E- E200 400 160 210 230 210 210

G- G- E200 200 200

G- G- G- G- G- G- E200 200 80 210 200 200 200

G150

Ethylene diamine H2N-CH2-CH2-NH2

117C 243F

G80

11

Ethylene glycol (ESC) HO-CH2-CH2-OH

198C 388F

G- G- E- G- G- E- E200 340 100 80 100 560 200

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

432

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E80 Brass

Chemical Resistance Guide


F C CR * ABS PVC PE PP 0

Ethylene oxide (G) CH2-CH2

10C 50F

technically pure, moist

Ethylenediaminetetraacetic acid (EDTA) C10H16N2O8

Fatty acids>C6 (ESC) R-COOH

Fatty alcohol sulphonates (ESC)

Fertilizers

Fluorine (G) F2

Fluoroboric acid HBF4

Fluorosilicic acid (Q/E) H2SiF6

O C S L A
technically pure aqueous + + 0 + + 0 + + + + + 0 + + + + + + + + + + + + + + + + + + + + aqueous + + 0 + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + technically pure 32%, aqueous + + + + + + + + + + + + + + + + + + + 0 0 0 + 0 40%, aqueous 210C 410F technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + 0 + + 0 + + 0 E- E- G- E- U130 340 340 210 60 G560 G- E200 210 + + + + + + + 0 + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

G- G- E220 400 200

G- E400 80

+ + +

+ + +

+ + 0

+ + +

+ + + +

Formaldehyde (ESC) HCHO

Formamide HCONH2

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

433

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + 0 ABS PVC PE + + + PP + + 0

Formic acid (ESC) HCOOH

up to 50%, aqueous

Formic acid (ESC)

25%

Formic acid (ESC) HCOOH

101C 214F

Frigen 12 (Freon 12) (D/P, G) CCl2F2

-30C -22F

Freon 13 (see tri floro, trichloroethane)

Fruit juices (ESC)

Fruit pulp

Fuel oil

O C S L A
technically pure technically pure + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + G- G- G100 350 340 + 0 + + 0 0 + + + + + + + + + + + + + 0 G- G- G140 140 80 technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + 0 + + 0 0 0 0

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + + + + + + + +

+ + 0

+ + 0 -

+ + + 0

E- G- G- U200 400 210 60 U210

U60

E- G200 120 U130

+ + +

+ + +

+ + +

+ + + +

+ + +

+ 0 -

+ + +

+ 0 -

+ + + + +

+ + + 0

+ 0 -

+ + + 0

U- E60 100

G- G- G80 200 200

Furfuryl alcohol (ESC) C5H6O2

171C 340F

11

Gasoline (see Benzine)

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

434

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E200 Brass U60

Chemical Resistance Guide


F C CR * + + ABS PVC PE + + + PP + + +

Gelatin

all, aqueous

Glucose C6H12O6

Melting Point 148C 298F

all, aqueous

Glycerol HO-CH2-CH(OH)-CH2OH

290C 554F

Glycocoll (ESC) NH2-CH2-COOH

Melting Point 233C 451F

Glycolic acid HO-CH2-COOH

Melting Point 80C 176F

Heptane (ESC) C7H16

98C

208F

Hexane (ESC) C6H14

69C

156F

Hydrazine hydrate (ESC) N2N-NH2.H2O

113C 235F

O C S L A
technically pure + + 10%, aqueous + + + + + + + + + + + + 0 + + + 0 + + + 37%, aqueous + + + + + + + + + + + + + + 0 + 0 + 0 technically pure + + + + + + + + + + + + + + + + + + + + 0 + 0 + 0 + 0 technically pure + + + + + + + + + + 0 E- E- G250 250 80 + aqueous + + + + + + + 0 + aqueous, 50% 5%, aqueous 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + 0 + + + 0 + + + + 0 + + 0 + + + 0 + 0 U60 U60 U60 + + 0 + + + + + + + + 0 + + + 0 0 -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ +

+ + +

+ + +

+ + + +

+ +

+ +

+ +

+ +

G- G- G- G150 350 170 80

U60

+ + 0

+ + + +

+ + +

+ + +

+ + + +

+ + + + + + + + + + + + + + +

+ + + +

+ + + + + + + 0 -

+ + + +

+ + + +

+ + + +

G- G- G- G- U80 400 200 80 170

+ + +

+ + + +

+ +

+ + +

+ + + + +

+ 0 0

+ + + 0

+ + + + 0

+ + + + 0

G- G- G- G- G- E- G200 340 100 200 350 200 200

G- E350 250

Hydrobromic acid (ESC) HBr

124C 255F

U60

Hydrochloric acid (Q/E, D/P, G) HCl

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

435

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass U60 U60

Chemical Resistance Guide


F C CR * 0 0 0 ABS PVC PE + + + PP + 0 -

Hydrochloric acid (Q/E, D/P, G) HCI 36%, aqueous

Hydrochloric acid (Q/E, D/P, G) HCI up to 38%

Hydrochloric acid (Q/E, D/P, G) HCI

Hydrochloric acid (Q/E, D/P, G) HCI

Hydrocyanic acid (G) HCN

26C 79F

Hydrofluoric acid (G) HF

Hydrogen (G) H2

-253C -423F

Hydrogen chloride (Q/E, G) HCI

-85C

-121F

O C S L A
up to 30% aqueous + 0 10%, aqueous + + 0 + + + + + + + + + + + 0 0 technically pure + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + 0 + 0 + 0 0 + 0 G- G- G200 350 80 40% + 0 0 + + 0 + + + + + + + + + + 0 + + 0 U60 U60 U60 technically pure + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + technically pure, gaseous + + 0 + + + 0 + + + + + + + + + + + 0 0 + + + + + + 0 0 0 10%, aqueous 90%, aqueous 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + + + + + + + 0 + 0 0 + + 0 + + 0 0 0 E120 G180

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + 0 0

+ + + + + + + + + + + + + + +

0 -

+ 0 -

0 -

+ + +

+ + +

+ +

+ +

+ + 0

+ + + +

0 -

+ + +

+ 0 0 -

+ + 0

+ 0 -

G- G80 200

U- G- U60 200 60

E- E- E- E- E- E560 560 560 560 560 560

E- E- U- G- G- E560 560 60 200 80 560

Hydrogen peroxide (ESC) H2O2

11

Hydrogen peroxide (ESC) H2O2

139C 282F

E- E- U120 340 60 G180

U- E- G60 200 200

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

S- S200 400 NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

436

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C E80 Titanium E210 Brass

Chemical Resistance Guide


F C CR * ABS PVC PE + PP +

Hydrogen peroxide (ESC) H2O2 50%, aqueous

Hydrogen peroxide (ESC) H2O2

105C 221F

30%, aqueous

Hydrogen sulphide (G) H2S

Hydrogen sulphide (G) H2S

Hydroquinone C6H4(OH)2

Hydroxylamine sulphate (NH30H)2SO4

Iodine-potassium iodide solution (lugols solution) l-KI

Iodium I2

185C 365F

O C S L A
technically pure saturated, aqueous + + 0 + + + + + + + + + + + + + + + 0 + + + 0 U- G- G60 560 80 + + + + 30% + + + + + + + + + + + + all, aqueous + + + + + + + + + + 0 0 + + + + + + + 100% saturated saturated 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ 0 -

G- G- E- U210 400 350 60

U60

+ + +

+ + +

+ +

+ + 0

+ + +

+ + + + + + + + + + + +

+ -

+ + 0 -

+ 0 -

0 -

+ 0 0 -

G- E- G- G560 170 550 80 G560

G- G- E80 300 80

U- G- E- E60 500 100 80 G300

Iron (II) -chloride FeCI2

Iron (II) -nitrate Fe(NO3)2

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

437

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + + + ABS PVC PE + + + PP + + + +

Iron (III) -chloride FeCl3 saturated

Iron (III) -chloridsulfate FeCISO4

saturated

Iron (III) -sulfate Fe2(SO4)3

Iron salts

Isooctane (ESC) (CH3)3-C-CH2-CH-(CH3)2

99C

210F

Isophorone (ESC) C9H14O

Isopropyl alcohol (ESC) (CH3)2-CH-OH

82C

180F

Isopropyl ether (CH3)2-CH-O-CH-(CH3)2

68C

154F

O C S L A
saturated all, aqueous + + 0 + + + + + + + + + + + + + + + 0 + 0 technically pure + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 technically pure + + technically pure + + + 0 + 0 0 technically pure + + + 0 G200 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + 0 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + + + + + + + + + + + + + +

+ + + +

+ + + + + + + + + + + + + + +

+ + +

+ + + +

+ + +

+ + + +

+ + + +

+ + +

+ + + +

+ + +

+ + + +

+ + + +

Isopropylbenzene CaH12

11

Jam, Marmalade

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

438

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C G80 Titanium E80 Brass G80

Chemical Resistance Guide


F C CR * + 0 + + + 0 ABS PVC PE + + + PP + + + + + + + +

Lactic acid (ESC) CH3CHOHCOOH

10%, aqueous

Lanolin (ESC)

technically pure

Lead acetate Pb(CH3COO)2

Lead carbonate PbCO3

Lead fluoroborate Pb(BF4)2

Lead nitrate Pb(NO3)2

Lead salts PbCI2, Pb(NO3)2, PbSO4

Linoleic acid

O C S L A
aqueous, saturated + + + + + + + + + + + + saturated + + + + + + + + + technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 G80 G80 G80 G80 + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ 0 -

+ + + +

+ 0 -

+ + 0 0 + + + + + + + + + + +

0 -

+ 0 0 0

0 0 0

+ 0

+ + +

+ + +

+ + +

+ + +

0 -

+ + +

+ + + +

+ + +

+ + +

+ + +

+ + +

+ + +

+ + +

+ + +

Linseed oil (ESC)

Liqueurs

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

439

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass G80

Chemical Resistance Guide


F C CR * + 0 ABS PVC PE + + + PP + + + +

Liquid fertilizers

Lithium bromide LiBr

Lithium sulfate Li2SO4

Lubricating oils

Magnesium salts MgCl2, MgCO3, Mg(NO3)2, Mg(OH)2, MgSO4

Magnesium-hydrogen carbonate

Maleic acid (ESC) (CH-COOH)2

Melting Point 131C 268F

Mercury Hg

357C 675F

O C S L A
+ + + 0 + + 0 0 all, aqueous, saturated + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + 0 + 0 G- G- G170 170 170 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + cold saturated, aqueous + + 0 + + + + + + + + + pure + + + + + + + + + + + + + + + + + + + + + + + + + + G- G200 400 + + + + + + + + + + + + + + + E- E- U560 560 60 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + + + + + +

G170

U60

G- E200 200

U- G- E- E60 180 560 560

Mercury (ll) -chloride HgCl2

11

Mercury (ll) -cyanide Hg(CN)2

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

440

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E200 Brass E80

Chemical Resistance Guide


F C CR * + + + + + + 0 0 ABS PVC PE + + + PP + + + +

Mercury (ll) -cyanide Hg(NO3)2

Mercury (ll) -sulfate HgSO4

Mercury salts HgNO3, HgCl2, Hg(CN)2

Methane see natural gas (G) CH4

-161C 258F

Methanol (ESC) CH3OH

65C

149F

Methyl acetate CH3COOCH3

56C

179F

Methyl amine (G) CH3NH2

-6C

21F

Methyl bromide (G) CH3Br

4C

39F

O C S L A
+ + + + + + + + + 0 + + + + + + + 0 + 0 0 0 + + + + + 0 + + + + + + 0 + 0 0 + + 0 + + + 0 + + + 0 0 technically pure technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 0 + + + U60 + 0 + 0 0 -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 technically 140 pure 176 212 248 68 104 140 all 176 212 248 68 104 technically 140 pure 176 212 248 68 104 32%, 140 aqueous 176 212 248 68 104 techincally 140 pure 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + + + + + + + + + + + + + + + + + +

+ + +

+ + + +

+ + +

+ + +

+ + +

+ + + +

+ + +

+ + + +

+ + +

+ + + +

+ + +

+ + +

+ + 0

+ + +

+ + +

+ + +

+ +

+ + +

0 0 -

0 0 -

E- E- E- E- G- E- G560 560 200 80 350 210 200

G- G- G- G- G- E- G200 350 150 200 200 250 80

G- U400 60

Methyl chloride (G) CH3Cl

-24C -11F

U60

Methyl ethyl ketone CH3COC2H5

80C 176F

G- G- G- G- G- G- G150 350 150 210 150 200 200

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

441

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + ABS PVC PE 0 PP 0

Methylene chloride CH2Cl2

40C 104F

technically pure

Methylisobutylketone C6H12O

Methylmethacrylate C5H8O2

Methylphenylketone (Acetophenon) C8H8O

Milk (ESC)

Mineral oils, free of aromatics

Mineral water

Mixed acid HCl CH3OH

O C S L A
+ + + + + + + + + + + + + + + + + + + + 0 + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 0 + + + + + + + + + + + + + + + + + + + + + 90% 10% 3 parts 1 part 2 parts 48% 49% 43% 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 0 0 0 + + + + 0 + 0 + 0 + + -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ 0 0

E- E- E- S- G- E210 350 200 80 160 100

Mixed acids -nitric 15% HNO3 -hydrofluoirc 15% HF -sulphuric 18% H2SO4 Mixed acids -sulphuric H2SO4 -nitric HNO3 -water H2O

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

442

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * 0 0 + 0 + + + 0 ABS PVC PE PP -

Mixed acids -sulphuric H2SO4 -nitric HNO3 -water H2O

10% 87% 43%

Mixed acids -sulphuric H2SO4 -nitric -water HNO3 H2O

50% 50% 40%

Mixed acids -sulphuric H2SO4 -nitric HNO3 -water H2O

Mixed acids -sulphuric H2SO4 -nitric -water HNO3 H2O

Mixed acids -sulphuric H2SO4 -nitric HNO3 -water H2O

Mixed acids -sulphuric H2SO4 -nitric -water HNO3 H2O

Molasses

Monochloroacetic acid ethy ester CICH2COOC2H5

144C 291F

O C S L A
50% 31% 19% 10% 20% 70% + + + 0 + + + + + + + + 0 50% 33% 17% + 0 + + + 0 30% 60% 10% + + + + + + 0 + 0 + + + + + + + + 0 + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + E- E- G200 350 80 technically pure + + + + + + 0 0 technically pure usual commerical 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + 0 + 0 0 G320 + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

0 -

G- G- E80 100 100

Morpholin C4H9NO

129C 264F

Mowilith D

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

443

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C S180 Titanium E280 G390 E280 G380 Brass

Chemical Resistance Guide


F C CR * ABS PVC PE + 0 PP +

11

68 104 technically 140 pure C10H8 176 424F 212 248 68 104 Nickel salts cold saturated, 140 (CH3COO)2Ni, NiCl2, aqueous 176 Nl(NO3)2, NiSO4 212 248 68 Nitrating acid 104 H2SO4 65% 20% 140 HNO3 15% 176 H2O 212 248 Nitric acid 68 HNO3 104 6.3%, 140 (see note 2.3.1 on joining aqueous in the GF Eng. Handbook 176 or call the sales office) 212 (ESC, G) 248 Nitric acid 68 HNO3 104 up to 40%, 140 (see note 2.3.1 on joining aqueous 176 in the GF Eng. Handbook or call the sales office) 212 (ESC, G) 248 68 Nitric acid HNO3 104 140 (see note 2.3.1 on joining 85% 176 in the GF Eng. Handbook 212 or call the sales office) 248 (ESC, G) 68 Nitric acid HNO3 104 140 (see note 2.3.1 on joining 100% 176 in the GF Eng. Handbook 212 or call the sales office) 248 (ESC, G) 68 Nitric acid 104 HNO3 65% 140 (see note 2.3.1 on joining in the GF Eng. Handbook (Metal - 70%) 176 212 or call the sales office) 248 (ESC, G) 68 104 Nitric oxide 140 see Nitrous gases (G) 176 NOx 212 248 68 104 Nitrilotriacetic acid 140 N(CH2-COOH)3 176 212 248 Naphthalene 218C

O C S L A
+ + + + + + + + 0 + + + + + 0 + + + + + + + 0 + + 0 + 0 E- E- U200 200 60 G290 + + 0 + + + 0 0 0 0 0 + + + + + + + + + 0 + + 0 0 0 E- E- U200 90 60 G240 E- E- E80 100 80 U- U90 110 0 0 + + 0 + + + 0 + 0 0 E100 G160 S200 E- E90 60 G400 20 40 60 80 100 120 20 40 60 80 100 120 + + +

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + +

+ + +

0 -

E- E- G- G400 400 210 80

G80

G- E80 210

+ + 0

+ + +

+ + +

+ + +

+ + +

+ + + + + + +

+ +

+ + + + +

+ + +

+ + +

+ + +

G80

U60

U60

U- G60 300

U60

U60

E- E200 280 G400

U60

U- E60 100 G150

U60

U60

G- G80 200

U60

U- E60 130 S200

U- S210 500

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

444

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E210 Brass

Chemical Resistance Guide


F C CR * ABS PVC PE + 0 0 PP + +

Nitrobenzene C6H5-NO2

209C 408F

technically pure

Nitrotoluene (o-, m-, p-) C7H7NO2

222238C 432460F

technically pure

Nitrous acid HNO2

Nitrous gases see Nitric oxide NOx

N-Methylpyrrolidon C5H9NO

N,N-Dimethylaniline C6H5N(CH3)2

n-Pentylacetate C7H14O2

Oleic acid (ESC) C17H33COOH

O C S L A
+ 0 + diluted, moist, anhydrous + + + + 0 + + + + + 0 + + + 0 + 0 + + 0 + + + technically pure technically pure + + + 0 + + 0 + + 0 + + + + + + + 0 0 E300 U310 10% SO3 traces 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ 0 -

G- G- E- G- G210 340 80 210 160 G90

+ 0

+ 0

+ + + + 0 + + +

0 -

0 -

+ +

+ +

E- G- S- G- G- E300 80 200 80 200 80 S400

Oleum (ESC,G) H2SO4+SO3

Oleum vapours (ESC) SO3

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

445

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + + 0 + + + + ABS PVC PE + + 0 PP + + + +

Olive oil (ESC)

Oxalic acid (ESC) (COOH)2

Oxygen (G) O2

Ozone (ESC,G) O3

Ozone (ESC,G) O3

Palm oil, palm nut oil (ESC)

Palmitic acid (ESC) C15H31COOH

Paraffin emulsions

68 104 140 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 technically 140 pure 176 212 248 68 104 up to 2%, 140 in air 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 140 176 212 248 68 104 390C technically 140 pure 176 734F 212 248 68 104 usual 140 commercial, 176 aqueous 212 248

O C S L A
+ + 0 0 0 0 + + + + 0 0 0 + 0 0 + + 0 + 0 + + + 0 + + 0 + + + + + + + + + + 0 + 0 0 + + 0 0 + + + + + + 0 + 0 0 + 0 + + + + 0 + + 0 + + 0 + + + + + + + + + + + 0 + 0 + technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + 0 + + + + + 0 0 0 + + + + + + + + + + + + + + 0 + 0 0 + 0 0 + -

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + + +

+ + +

+ + 0 -

+ + +

+ + + 0

+ +

+ + +

+ + +

+ + + + + + + + + 0 0 0 -

+ + 0 -

0 -

0 0 -

+ + +

+ + +

+ + 0

+ + 0

+ + +

+ + + + + + +

+ + + + +

G- G- G80 350 80

G- G80 100

G- G- G- S- S- G400 400 350 200 100 100

Paraffin oil

11

p-Dibromo benzene C6H5Br2

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

446

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium U60 U60 E200 Brass U60 U60 G80

Chemical Resistance Guide


F C CR * ABS PVC PE + + + PP + + +

Perchloric acid

Perchlorid acid (ESC) HCIO4

10%, aqueous

Perchlorid acid (ESC) HCIO4

Perchloroethylene (tetrachlorethylene) Cl2C=CCl2

121C 250F

Petroleum

Petroleum ether (ESC)

40C 70C

104F 158F

Phenol (ESC) C6H5-OH

182C 360F

Phenol (ESC) C6H5-OH

O C S L A
70%, aqueous 0 0 technically pure + + + 0 + + + 0 E80 G560 + technically pure + + 0 + 0 0 technically pure + + + + 0 0 + 0 0 + + + + + + + + + + + + + 0 + + + 0 G80 G80 G80 + + 0 + 0 + 0 + + up to 10%, aqueous + + 0 + + + + + + + + + 0 + + + 0 0 up to 90%, aqueous + + 0 + + + + + 0 + 0 0 up to 5% technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + 0 0 + 0 + + + 0 0 0 + + 0 -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + +

+ + + + + + + + + +

+ 0

+ + + 0

+ + 0 -

U60

U60

U60

U60

+ 0 -

0 -

+ + + 0

+ + 0

U60

U60

U60

U60

E- G- G- G80 350 80 110 G560

G- G- E- G- G- G- G210 210 150 120 200 350 120

Phenol (ESC) C6H6O

Phenylhydrazine C6H5-NH-NH2

243C 469F

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

447

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C G560 Titanium Brass

Chemical Resistance Guide


F C CR * 0 + ABS PVC PE PP + 0 0

Phenylhydrazine hydrochloride C6H5-NH-NH2HCI aqueous

Phosgene (ESC,G) COCI2

8C 46F

liquid, technically pure

Phosgene (ESC,G) COCI2

Phosphoric acid H3PO4

Phosphoric acid H3PO4

Phosphoric acid H3PO4

Phosphoric acid H3PO4

Phosphoric acid H3PO4

O C S L A
gaseous, technically pure up to 30%, aqueous + + 0 + + + + + + 0 + + + + + + + 75% + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + + 0 0 0 + + + 0 + + + 0 + + up to 95% + + + + + + + 0 + + 0 85%, aqueous + + + + + + + + + 0 + + 0 + + + + 50%, aqueous + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + 0 + + + + 0 + + + + 0 + + 0 + 0 + 0 0 + + 0 + + + + 0 C F technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + 0 -

0 -

+ + 0 -

G- G200 200

+ 0 0

+ +

+ + 0

+ + +

+ 0 -

+ 0

Phosphoric acid tributyl ester (H9C4O)3P=O Phosphorous chlorides:

11

-Phosphorous trichloride 175 347 PCl3 -Phosphorous pentachloride 162 324 PCl5 -Phosphorous oxychloride 105 221 POCl3 (ESC)

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

448

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + + + + + + + 0 ABS PVC PE + + 0 PP + +

Photograaphic developer (ESC)

Photographic emulsions (ESC)

Photographic fixer (ESC)

Phthalic acid (ESC) C6H5(COOH)2

Melting Point 208C 406F

Phthalic acid dioctyl ester C24H38O4

Picric acid (ESC) C6H3N3O7

Melting Point 122C 252F

Potash lye KOH

Potash see potassium carbonate K2CO3

O C S L A
+ 0 + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + 0 0 + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 0 + + + + + + + + + saturated 50% 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 usual 140 commercial 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 saturated, 140 aqueous 176 212 248 68 104 140 176 212 248 68 104 1%, 140 aqueous 176 212 248 68 104 140 50% 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + + 0

+ + 0

+ + +

+ +

+ +

0 0

+ +

+ +

+ + 0

+ +

+ +

+ +

+ + +

+ +

+ +

+ +

+ + 0

+ + +

+ + 0

+ +

+ +

+ + +

+ +

+ +

+ +

+ +

G- E- G- G- S- G- E560 560 350 320 100 300 80

Potassium acetate (ESC) CH3COOK

Potassium aluminium sulfate (alum) KAI(SO4)2

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

449

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E200 Brass

Chemical Resistance Guide


F C CR * 0 + + + + + + 0 0 + + + + 0 ABS PVC PE + + + PP + + + + + + + +

Potassium bichromate (ESC) K2Cr2O7

107C

Potassium borate K3BO3

Potassium bromate KBrO3

Potassium bromide KBr

Potassium carbonate (potash) K2CO3

Potassium chlorate (ESC) KCIO3

Potassium chlorate (ESC) KCIO3

Potassium chloride KCI

68 104 saturated, 140 aqueous 176 225F 212 248 68 104 10%, 140 aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 all, 140 aqueous 176 212 248 68 104 140 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 cold saturated, 104 aqueous 140 176 (Metal - 30%) 212 248 68 104 140 all, aqueous 176 212 248

O C S L A
+ + 0 + + + + + + + + + + + + + + + + + + + + + + + + 0 0 + + + + + G- G- G200 350 80 + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + 0 + 0 + + + 0 + + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + 0 + 0 + + + 0 G- E- G200 350 80 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + E- E- U200 350 60 68 104 cold saturated, 140 aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + 0 + + 0 + + 0 + + 0 + + + + + + + + + + + + + + + + + + + + 0 + + + + + + 0 + + + + G- G- U200 200 60

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + +

+ + +

+ + + + + + + + +

+ + +

+ 0

+ + +

+ + 0

+ + + +

+ + +

+ + +

+ + +

+ + +

+ + +

+ + 0

+ + + +

+ + +

+ + 0

+ + + + +

+ + + + + + + + + + + +

+ + +

+ + + +

+ + + + +

+ + + + +

U60

E- E80 200 G200

U60

G- G- E80 200 200

S- G80 200

Potassium chromate (ESC) K2CrO4

11

U- G- G- U60 200 200 60

Potassium cyanide KCN

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

450

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + 0 ABS PVC PE + + + PP + + +

Potassium dichromate K2Cr2O7

Potassium fluoride KF

Potassium Hexacyanoferrate -(II) K4[Fe(CN)6].3H2O

Potassium hexacyanoferrate -(III) K3[Fe(CN)6].

Potassium hydrogen carbonate KHCO3

Potassium hydrogen sulphate KHSO4

Potassium Hydroxide see Caustic potash

Potassium iodide KJ

O C S L A
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + G- G- S200 200 100 50%, aqueoous 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 140 saturated 176 212 248 68 104 140 saturated 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 saturated 176 212 248 68 104 140 saturated 176 212 248 68 104 140 176 212 248 68 cold saturated, 104 aqueous 140 176 (Metal - 70%) 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + + +

+ + + + + + + + + + + + + + +

+ + +

+ + + +

+ + +

+ + + +

+ + +

+ + + +

+ + +

+ + + +

S- G- E100 200 200

G- G- E- G- G- G- E200 350 350 200 120 200 200

Potassium nitrate KNO3

Potassium nitrite KNO2

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

451

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + 0 ABS PVC PE + PP

Potassium perchlorate (ESC) KCIO4

Potassium Permanganate (ESC) KMnO4

Potassium persulphate (ESC) K2S2O8

Potassium phosphate KH2PO4 and K2HPO4

Potassium sulphate K2SO4

Potassium sulphide K2S

Potassium sulphite K2SO3

Potassium tartrate C4H4K2O6

O C S L A
+ + 0 + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + 0 + 0 + + + 0 + + 0 + + + + + + + + + + + + + + + + + + 0 0 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + 0 + + 0 + + + + 0

68 104 cold saturated, 140 aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 140 all, aqueous 176 212 248 68 104 140 all, aqueous 176 212 248 68 104 140 all, aqueous 176 212 248 68 104 140 saturated 176 212 248 68 104 140 saturated 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + + +

+ + + +

+ + + +

+ 0

+ + + 0

G350

+ + 0

+ +

+ + 0

+ +

+ + + + + + + + +

+ + + +

0 -

0 -

+ + +

G- G- G- G- G200 350 200 200 80

E- E80 80 G200

+ + 0

+ + +

+ + +

+ + +

+ + +

+ +

+ + + + +

+ + + 0

+ + + 0

G350

Potassiumhydrogensulfite KHSO3

11

Potassiumhypochlorite KOCI

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

452

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium G200 Brass

Chemical Resistance Guide


F C CR * + + + + + + 0 0 + + ABS PVC PE + PP +

Potassiumperoxodisulfate K2S2O8 saturated

Propane (G) C3H8

-42C 44F

technically pure, liquid

Propane (G) H3C-CH2-CH3

Propanol, n- and iso(ESC) C3H7OH

97C bzw. 82C

Propargyl alcohol (ESC) CHcC-CH2-OH

114C 237F

Propionic acid (ESC) CH3CH2COOH

141C 286F

Propionic acid (ESC) H3C-CH2-COOH

141C 286F

Propylene glycol C3H8O2

188C 370F

O C S L A
technically pure, gaseous technically pure + 0 0 + + + + + + + + + 0 + + + + + + 0 + 0 0 7%, aqueous + + + + + + + + + + 0 0 + + + + + + + + + + 0 50%, aqueous + + 0 0 + + + + + + + + + + + + + 0 0 + 0 0 technically pure + 0 0 + 0 0 + + + + 0 + + + 0 technically pure + + + 0 + + + + + + + + + + + + + 0 + 0 + + + G- G200 170 technically pure technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 0 + + + 0 0 + 0 0 0 0 0 + 0 -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + +

+ + +

G200

Propylene oxide C3H6O

35C 95F

Pyridine C5H5N

115C 239F

G- G- G- G- G200 350 350 200 120

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

453

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E200 Brass

Chemical Resistance Guide


F C CR * + + + + 0 + + + + + + + ABS PVC PE PP

Pyrogallol C6H3(OH)3

Ramsit fabric waterproofing agents

Salicylic acid C6H4(OH)COOH

Sea water see Brine

Silicic acid Si(OH)4

Silicone oil

Silver Cyanide AgCN

Silver salts AgNO3 AgCN AgCI

O C S L A
+ + + + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + all, aqueous all, aqueous 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + G80 G- G- G- G80 300 80 160 + + + + + + + + + + + + + + + + + + + + + + + 0 G- G- E- G560 560 80 200

68 104 140 100% 176 212 248 68 104 usual 140 commercial 176 212 248 68 104 140 saturated 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 saturated 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ +

+ + +

+ + +

+ +

+ + +

+ + +

+ + + +

+ + +

Soap solution (ESC)

11

Sodium acetate CH3COONa

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

454

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E200 Brass

Chemical Resistance Guide


F C CR * + + ABS PVC PE + + + + + + PP + + + + + + + +

Sodium aluminium sulfate

Sodium arsenite Na3AsO3

Sodium benzoate C6H5-COONa

Sodium bicarbonate NaHCO3

Sodium bisulphate NaHSO4

Sodium bisulphite NaHSO3

Sodium borate Na3BO3

Sodium bromate NaBrO3

O C S L A
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + E- E- G200 350 80 + + 0 + + + + + + + + + + + + + + + + + + + 0 + + + + + 0 + 0 + + 0 + + E160 U170 + 0 + + + + + + + + + + + + + + + 0 0 + + 0 + + + 0 U60 + + + + + + + + + + + + + + + + + + + + + 0 + + + 0 + 0 + + + + + + + + + + 0 + + 0 + + + 68 104 140 all, aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + 0 + + 0 + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 saturated 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 140 10%, aqueous 176 212 248 68 104 140 all, aqueous 176 212 248 68 104 140 saturated 176 212 248 68 104 140 all, aqueous 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + +

+ + + +

+ + +

+ + 0

+ + + +

+ + +

+ + +

+ + + + 0

+ 0

+ + + 0

+ +

+ + 0

G- E100 80

G- S80 100

E- U- G160 60 200 U170

G90

U60

Sodium bromide NaBr

Sodium carbonate (soda) Na2CO3

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

455

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + 0 0 + + 0 + + + + + + + + + ABS PVC PE + + + PP + + +

Sodium chlorate (ESC) NaCIO3 all, aqueous

Sodium chloride NaCI

all, aqueous

Sodium chlorite (ESC) NaCIO2

Sodium chromate (ESC) Na2CrO4

Sodium cyanide NaCN

Sodium dichromate Na2Cs2O7

Sodium disulphite Na2S2O5

Sodium dithionite hyposulphite

O C S L A
diluted, aqueous + diluted, aqueous + + 0 + + + + + + + + + + + + + + + + + + 0 + + 0 + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + all, aqueous + + 0 + + + + + + + + + + + + + + 0 + + 0 up to 10%, aqueous 68 104 cold saturated, 140 aqueous 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + + +

+ + +

0 + 0 + + + + + + 0 0 + + + +

+ + + +

+ 0 -

+ + + 0

+ + +

+ + + +

+ +

+ + +

+ + + +

+ + + + + + + + + + +

+ + + +

+ 0

+ 0

Sodium fluoride NaF

11

Sodium hydrogencarbonate (sodium bicarbonate) NaHCO3

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

456

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium E80 E200 Brass

Chemical Resistance Guide


F C CR * + + + + + + + + + + ABS PVC PE + + + PP + + + +

Sodium hydrogensulfate NaHSO4

Sodium hydrogensulfite NaHSO3

Sodium Hydroxide see Caustic Soda

Sodium hypochlorite (ESC) Bleaching lye NaOCI stabilized by NaOH

Sodium iodide NaJ

Sodium nitrate NaNO3

Sodium nitrite NaNO2

Sodium oxalate Na2C2O4

O C S L A
+ + 0 + + 0 0 0 + + + + + 0 + + + + + + + + + + + + + + + + + + + + 0 + + 0 + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + 0 + + + + + + + + 0 + + + saturated saturated 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 12.5% active 140 chlorine, 176 aqueous 212 248 68 104 140 all, aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + + + + + + + + +

+ + +

+ + +

+ + +

+ + + +

+ + +

+ + + +

+ + +

Sodium perborate NaBO3 4H2O

Sodium perchlorate NaCIO4

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

457

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass U60

Chemical Resistance Guide


F C CR * + + + 0 + + + + + + ABS PVC PE + + + PP + + +

Sodium persulphate (ESC) Na2S2O8 cold saturated, aqueous

Sodium phosphate Na3PO4

cold saturated, aqueous

Sodium silicate Na2SiO3

Sodium sulfate

Sodium sulphate Na2SO4

Sodium sulphide Na2S

Sodium sulphite Na2SO3

Sodium thiosulphate Na2S2O3

O C S L A
all, aqueous + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + cold saturated, aqueous + + 0 + + + + + + + + + + + + + + + + + + + 0 0 0 0 + + + + + + + + + + + + + E400 cold saturated, aqueous + + 0 + + + + + + + + + + + + + + + + + + + + + + + + G200 U210 G- U200 60 U210 cold saturated, aqueous + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + 0 + + + + + + + + + + cold saturated, aqueous + 0 + + 0 + + 0 100mg CS2/1 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + +

+ +

+ + + + + + + +

+ + + 0

+ + 0

+ + + +

+ + +

+ + + + + + + + +

+ + + 0 + + 0 -

+ + +

+ + +

+ + +

+ + 0

+ + +

+ +

+ + +

+ + +

+ + +

+ + +

G- G- E- G- G- G- E200 350 80 200 200 200 200

G- G- G80 140 200

G- G80 200

Sodiumtetraborate (Borax) Na2B4O7

11

Spinning bath acids containing carbon disulphide (ESC)

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

458

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass G300

Chemical Resistance Guide


F C CR * + + + + + + + + + + 0 ABS PVC PE + PP +

Spinning bath acids containing carbon disulphide (ESC)

Spinning bath acids containing carbon disulphide (ESC)

Stannous chloride Tin II chloride

Stannous chloride - Tin IV chloride SnCl4

Starch solution (C6H10O5)n

Starch syrup (C6H10O5)n

Stearic acid (ESC) C17H35COOH

Styrene H5C6-CH=CH2

68 104 140 700 mg CS2/1 176 212 248 68 104 140 200 mg CS2/1 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 cold saturated, 140 aqueous 176 212 248 68 104 140 all, aqueous 176 212 248 68 104 usual 140 commercial 176 212 248 68 Melting 104 Point technically 140 pure 176 69C 212 156F 248 68 104 140 176 212 248 Melting point aqueous, all 185C 365F 68 104 140 176 212 248 68 104 140 176 212 248

O C S L A
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + + 0 + + + + + 0 0 + + + 0 + + + 0 + 0 + + + + + + + + 0 + usual commercial 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + G- G200 200 U210 + + 0 + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ +

+ +

G- E- G- S- S- E- E380 400 400 200 120 560 350 U390

G- E200 360

Succinic acid HOOC-CH2-CH2-COOH

Sugar syrup

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

459

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C U290 + + + 0 + Titanium Brass U60 U60

Chemical Resistance Guide


F C CR * + ABS PVC PE + + + PP + + + +

Sulfur S

Melting point 119C 246F

technically pure

Sulfur dioxide (G) SO2

-10C 14F

technically pure, anhydrous

Sulfur dioxide (G) SO2

Sulfur dioxide (G) SO2

Sulfur trioxide (G) SO3

Sulfuric acid saturated by Chlorine H2SO4+CI2

Sulfuric acid H2SO4

120C

(see note 2.3.1 on joining in the GF Eng. Handbook 240F or call the sales office) Sulfuric acid H2SO4

140C (see note 2.3.1 on joining in the GF Eng. Handbook 284F or call the sales office) (ESC) Sulfuric acid H2SO4 (see note 2.3.1 on joining in the GF Eng. Handbook or call the sales office) (ESC) Sulfuric acid H2SO4 (see note 2.3.1 on joining in the GF Eng. Handbook or call the sales office) (ESC)

O C S L A
technically pure, moist all, moist + + 0 + + + + + + + + + 0 + 0 + 0 0 U- G- U60 160 60 G- G560 90 60% + + + + + up to 40%, aqueous + + 0 + + + + + 0 + + + + + + up to 60%, aqueous + + + + + + + + + + + 0 + + + + + + + + + + + + + + 0 + + + 0 0 + 0 + + 0 0 + + 0 + + + 0 + 0 0 96%, aqueous 97% 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 + + + + + + + G- G- U80 200 60

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

0 -

+ + + + + + 0 0 -

+ + + +

+ + + +

E- E- E- G560 560 560 60 U80

U- E- E60 560 560

+ + +

+ + +

+ + +

+ + +

+ 0 -

+ 0

0 -

G- G- G- G- E- G- E560 560 300 300 120 560 300 G560

U- E- U60 180 60 U560

G- G- G- U80 200 560 60

G- E- U80 140 60 G280

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

460

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas
Sulfuric acid H2SO4

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C E100 Titanium Brass G80

Chemical Resistance Guide


F C CR * ABS PVC PE 0 PP 0

(see note 2.3.1 on joining in the GF Eng. Handbook 482F or call the sales office) (ESC) Sulfuric acid H2SO4 195C (see note 2.3.1 on joining in the GF Eng. Handbook 383F or call the sales office) (ESC) Sulfuric acid H2SO4 340C (see note 2.3.1 on joining in the GF Eng. Handbook 644F or call the sales office) (ESC)

250C

90%, aqueous

up to 80%, aqueous

Sulfurous acid H2SO3

Sulfuryl chloride SO2CI2

69C

156F

Surfactants (ESC)

Tallow (ESC)

Tannic acid (ESC)

O C S L A
98% saturated, aqueous + + 0 + + 0 + + + + + + + + + + + + 0 + + + 0 0 0 U60 E- G80 80 G140 U150 + 0 + G200 technically pure up to 5%, aqueous 0 0 0 + + 0 0 + 0 0 0 + + + + + technically pure + + + + + + + + + + + + + + + + + + + + + + + + + + + + + all, aqueous + + + + + + + + + + + + + + + G- G- U200 200 60 usual commercial all, aqueous 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + + E- E400 400

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ +

+ + +

+ + +

+ + + +

+ + 0

+ + 0

+ 0

+ + 0

+ + + + 0 0 + + + + + 0 -

+ +

0 0 -

+ + 0 -

+ 0 -

U- G- E60 200 180

U60

Tanning extracts form plants (ESC)

Tartaric acid HO2C-CH(OH)-CH(OH)CO2H

U- G60 200

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

461

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * 0 ABS PVC PE PP -

Tetrachlorethylene see Perchloroethylene CI2C-CCI2

121C 250F

Tetrachloroethane CI2CH-CHCI2

146C 295F

technically pure

Tetraethylene lead (ESC) (C2H5)4Pb

Tetrahydrofurane C4H8O

66C

151F

Tetrahydronaphthalene Teralin

207C 405F

Thionyl chloride SOCI2

79C

174F

Tin (IV) -chloride

Tin-(II)-chloride SnCI2

O C S L A
technically pure 0 0 0 G350 technically pure technically pure 0 + technically pure + + + + + + + + + + + + + + + + + + + + + + + + + + technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 0 0 + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + 0

+ + + + + +

Toluene C6H5-CH3

111C 232F

11

Triacetin (Glycerol acetate) (Glycerintriacetat) CaH14O6

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

462

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium U60 Brass G80 U60

Chemical Resistance Guide


F C CR * ABS PVC PE + + + PP + + +

Tributyl phosphate (C4H9)3PO4

289C 552F

technically pure

Trichloroacetic acid CI3C-COOH

196C 385F

technically pure

Trichloroacetic acid CI3C-COOH

Trichloroethane Methylchloroform

74C

165F

Trichloroethylene CI2C=CHCI

87C

189F

Trichloromethane Chloroform

61C

142F

Tricresyl phosphate (ESC) H3C-C6H5-O)3PO4

Triethanolamine (ESC) N(CH2-CH2-OH)3

Melting Point 21C 70F

O C S L A
50%, aqueous technically pure 0 technically pure + + + 0 + 100% technically pure + + + + 0 + 0 0 + + + + 0 0 G80 G80 G80 technically pure technically pure up to 50% 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + 0 G80 G80 + + + 0 0 -

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

G- G- G100 80 100

G- G80 100

+ 0 -

+ + 0

U60

U60

U60

U60

+ 0

+ + +

+ + 0

+ + 0 -

G80

Triethylamine (ESC) N(CH2-CH3)3

89C 192F

Trifluoro acetic acid (ESC) F3C-COOH

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

463

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass S80

Chemical Resistance Guide


F C CR * ABS PVC PE + + PP + 0

Trioctyl phosphate (ESC) (C8H17)3PO4 technically pure

Turpentine oil (ESC)

technically pure

Urea (ESC) H2N-CO-NH2

Melting point 133C 271F

Urine

Vaseline

Vaseline oil see paraffin oil

Vegetable oils

Vegetable oils and fats (ESC)

O C S L A
up to 30%, aqueous + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 0 + 0 technically pure + + + + + + + + + + + + + + + + + 0 + + + + + + + 0 0 + 0 0 + 0 + + 0 + + + + + + + + + + + 0 0 0 0 technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + 0 + + E- E160 150 G300

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ 0

0 0

+ + +

E- E- G200 190 80 G350

G- G- G80 100 80

+ + 0

+ + + 0

+ +

+ + +

+ + +

+ + + + 0

+ + +

+ + +

+ + +

+ + +

+ + +

E- E- G- G- G- G90 250 160 80 160 100

Vinegar (see Wine vinegar)

11

Vinyl acetate CH2=CHOOCCH3

73C 163F

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

464

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * 0 0 + + + + + + + + + + + 0 + + 0 + + + + + + + + + ABS PVC PE PP -

Vinyl chloride (G) CH2=CHCI

-14C 7F

technically pure

Viscose spinning solution

Waste gases containingAlkaline

Waste gases containingCarbon oxides

Waste gases containingHydrochloric acid

Waste gases containingHydrogen fluoride (ESC)

Waste gases containingNitrous gases

Waste gases containingSulphur dioxide

O C S L A
all + + + + + + + + + + + + + + all + + + + + + + + + + + + 0 traces + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + + 0 + + + + + + 0 + + + + + 0 + + + traces + + + + + + + + + + + + 0 + + + 0 + + + + 0 0 + + + 0 traces + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + 0 + + + + traces all 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + 0 + + + + + + + + + + + + + + 0 0 + + + + + + + + + + + + + + + + 0 + + + 0 + + + + + 0 + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ +

+ + +

+ + +

+ + +

+ + +

+ +

+ + +

+ + +

+ + +

+ + + +

+ + +

+ + + +

+ 0 -

+ + + +

+ + + 0 -

+ + +

+ + 0 -

Waste gases containingSulphur trioxide (ESC)

Waste gases containingSulphuric acid

11

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

465

ALSCO
Chemicals (Medium) and Formulas
Water - distilled - deionised H2O

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass G60

Chemical Resistance Guide


F C CR * + + + ABS PVC PE + + + PP + + + + + + + + +

100C 212F

Water, condensed

Water, drinking, chlorinate

Water, waste water without organic solvent and surfactants

Wax alcohol (ESC) C31H63OH

Wine vinegar (ESC)

Wines, red and white

Xylene C6H4(CH3)2

138C144C 280F291F

O C S L A
+ 0 + + + + + + + + + + + + + + + + + 0 + + + + + + + + 0 + + + + + + + technically pure + + + 0 0 0 + + + + + + + + + + + + usual commercial + + + 0 0 + + + + + + + + + + + + + 0 0 + 0 + 0 + + usual commercial + + + + + + + + + + + + + + + + technically pure + + 0 + 0 all, aqueous saturated 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + +

+ + 0

+ + + +

+ + +

+ + +

+ + +

+ + +

+ + +

+ + +

+ + + + +

+ + + + + + + + + + + + + + + + + + + + + + + + + + +

+ 0 -

+ 0

+ + + + + + + + + +

+ + + + + + + + 0

+ + + +

G- G- U200 250 60

U- E60 550

+ + +

+ + + +

+ + + + +

+ + + 0

+ + +

+ + + +

G- G- G- G- G- E- E200 200 200 200 200 320 200

Yeasts

11

Zinc chloride

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

466

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

ALSCO
Chemicals (Medium) and Formulas

TM

WARNING: No Guarantees can be given for the information contained in this Guide. Pilot installations should always be done! The follwing information is only a guide, Check with the manufacturer for their individual chemical resistance information! Concentration Temperature CPVC Boiling Point Plastics EPDM PVDF Elastomers Aluminum 304 SS 316 SS CSM * NBR * FPM * Metals Carbon Steel Hastelloy C Titanium Brass

Chemical Resistance Guide


F C CR * + + + + ABS PVC PE + + + PP + + + +

Zinc nitrate Zn(NO3)2 saturated

Zinc oxide ZnO

suspension

Zinc phosphate Zn3(PO4)2

Zinc salts ZnCI2, ZnCO3, Zn(NO3)2, ZnSO4

Zinc stearate Zn(C17H35-COO)2

Zinc sulfate ZnSO4

1-Chloropentane C5H11CI

1,1,2 - Trifluoro, 1,,2,2 -Trichloroethane (Freon 113) (ESC) FCI2C-CCIF2

47C

117F

O C S L A
saturated all, aqueous + + 0 + + + + + + + + + + + + + + + + + + + + + + + 0 + + + suspension + + + + + + + + + + + + + + + 0 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + technically pure 68 104 140 176 212 248 68 104 140 176 212 248 20 40 60 80 100 120 20 40 60 80 100 120

68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248 68 104 140 176 212 248

20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120 20 40 60 80 100 120

+ + +

+ + + +

+ + + + +

+ + +

+ + + +

+ + +

+ + + +

+ + +

+ + + +

+ + + + +

+ + +

+ + + +

11
NOTE: The numbers under letters in Metal section indicate temperature (F) Metal Material Ratings courtesy of Philip A. Schweitzer, Corrosion Resistance Tables, Marcel Dekker, Inc., 1976 * NBR = Nitrile Rubber * CR = Neoprene * FPM = Viton * CSM = Hypalon

Material Rating for Thermoplastics and Elastomers + Resistant 0 Conditionally resistant Not recommended Blank No data available, Consult Sales Office

Material Rating for Metals Only E < 2 Mils penetration / year G < 20 Mils penetration / year S < 50 Mils penetration / year U > 50 Mils penetration / year

ALSCO Industrial Products, Inc.

1265 Mount Vernon Rd. Lithia Springs, GA. 30122 FAX 770-739-7549

770-941-3030

1-800-849-3030

467