Vous êtes sur la page 1sur 24

CHIMIE DES SOLUTIONS

202 NYB 05

RÉPONSES AUX EXERCICES

CHRISTIAN LOUIS
1

1. Propriétés des solutions

1.1 CB = 0,668 mol/L

mB = 0,669 mol/kg

XB = 0,0119

1.2 (P.P.C.)B = 32,3 %

CB = 3,05 mol/L

mB = 5.17 mol/kg

XB = 0,288

1.3 CB = 3,35 mol/L

mB = 4,03 mol/kg

XB = 0,0677

1.4 (PPC)B = 21,4 %

mB = 1,42 mol/kg

XB = 0,0249

1.5 CB = 0,788 mol/L

XB = 0,0466

1.6 (PPC)B = 55,2 %

1.7 (PPC)B = 33,3 %

CB = 6,17 mol/L

mB = 6,71 mol/kg

XB = 0,108

1.8 PS = 3,14 kPa

1.9 PS = 25,1 kPa

YA = 0,510 YB = 0,490
2

1.10 a) PA = 3,17 kPa

b) PS = 2,85 kPa

c) PS = 4,76 kPa
1.11 YA = 0,871 YB = 0,129

1.12 tébS = 100,14°C tcS = - 0,51°C

1.13 ∆tc = 2,36 x 10-5 °C π = 0,0325 kPa

1.14 MMB = 2,66 x 104 g/mol

1.15 mB = 6,58 x 10-2 mol/kg

MMB = 6,4 x 102 g/mol

1.16 π = 2,5 x 103 kPa

1.17 Calculer les abaissements des points de congélation pour les solutions
suivantes :

a) ∆tc = 0,19 °C pour le glucose

b) ∆tc = 0,38 °C pour NaCl

c) ∆tc = 0,23 °C pour HOCl

d) ∆tc = 0,56 °C pour MgCl2

1.18 tc = - 2,8 °C

1.19 MB = 3,0 g de NaBr MC = 4,5 g de MgBr2

1.20 VS1 = 66,7 mL

1.21 CBf = 0,0500 mol/L

1.22 VS1 = 0,833 L

1.23 MB = 13,3 g
3

2. Équilibres chimiques

2.1 CA = 0,621 mol/L

2.2 CB = 1,00 mol/L

2.3 a) Kp = K (RT)

b) Kp = K

c) Aucun réactif n'est gazeux et on ne peut définir Kp

d) Kp = K (RT)

2.4 Kp = 1,4 x 102 (kPa)2

2.5 a) K = 14,1 (L/mol)1/2

b) K = 5,00 x 10-3 mol/L

c) K = 7,07 x 10-2 (mol/L)1/2

d) K = 4,00 x 104 (L/mol)2

2.6 K = 1,97 x 10-1

2.7 Kp = = 1,30 x 107 kPa3

2.8 K = 3,45

2.9 a) Il y a réaction (vers la droite)

b) Il y a réaction inverse (vers la gauche)

c) Il y a équilibre

d) Il y a réaction inverse (vers la gauche)

2.10 a) Il y a réaction inverse (vers la gauche)

b) Il y a équilibre

c) Il y a équilibre

d) Il y a réaction (vers la droite)


4

2.11 [HOCl] = 0,0092 mol/L

[H2O] = 0,050 mol/L

[Cl2O] = 0,018 mol/L

2.12 P(N2O4) = 0,60 kPa

P(NO2) = 3,9 kPa

2.13 [Fe(SCN)2+] = 0,050 mol/L

[SCN-] = 0,95 mol/L

[Fe3+] = 4,8 x 10-5 mol/L ≈ 0

2.14 a) Droite

b) Droite

c) Aucune réaction

d) Gauche
5

6. Cinétique chimique

3.1 vNH = 0,0053 mol/L.s


3

d[N2]/dt = - 0,0027 mol/L.s

3.2 a) Unités de v : mol/L.min. ou mol.L-1min-1

b) Unités de k : mol/L.min. ou mol.L-1min-1

c) Unités de k : min-1

d) Unités de k : L.mol-1min-1

3.3 v = k [NO]2 [F2

k = 1,8 x 102 L2.mol-2.min-1

3.4 v = k [Cl-]2

k = 1,9 x 10-3 L.mol-1.s-1

3.5 v = k [CO2]2

k = 6,64 L. mol-1 s-1

3.6 a) k = 5,21 x 10-8 min-1 ou 0,0274 an-1

b) Vitesse initiale = 0,137 g/an ou 6,6 x 1014 noyaux/min

Masse = 4,86 g

3.7 k = 5,2 x 10-3 s-1

t 2
1/2 = 1,3 x 10 s

3.8 k = 1,62 x 10-1 L/mol.s


6

4. Thermodynamique chimique

4.1 a) Fusion d'un solide Augmentation

b) Évaporation d'un liquide Augmentation

c) Sublimation d'un solide Augmentation

d) Congélation d'un liquide Diminution

e) Homogénéisation de 2 gaz Augmentation

f) Séparation de 2 solides Diminution

g) Diffusion d'un gaz dans un autre Augmentation

4.2 b), c), d)

4.3 ∆S = 117 J/mol. K

4.4 ∆Go = 7,99 x 101 kJ/mol

4.5 ∆Go = - 5,9 x 104 J/mol

K = 2,20 x 1010

4.6 ∆G = -1,88 x 102 kJ/mol


7

5. Acides et bases

5.1 a) HNO3 Acide fort f) Zn(OH)2


Amphotère

b) H2PO4- Amphotère g) HCO2H Acide faible

c) CH3NH2 Base faible h) H2NCH2CH2NH2 Base


faible

d) Ca(OH)2 Base forte i) Na2SO4 Sel

e) CH4 Espèce neutre j) Ba2+ Espèce neutre

5.2 a) H 2O + HNO2 ↔ H3O+ + NO2- Réaction vers la gauche

Base Acide Conjugué Conjugué


acide basique

b) H 2S + C2H5NH2 ↔ HS- + C2H5NH3+ Réaction vers la droite

Acide Base Conjugué Conjugué


basique acide

c) H2SO4 + H2O ↔ H3O+ + HSO4- Réaction vers la droite

Acide Base Conjugué Conjugué


acide basique

d) H 3 O+ + OH- ↔ H 2O + H 2O Réaction vers la droite

Acide Base Conjugué Conjugué


basique acide

e) H2PO4- + H2O ↔ H3PO4 + OH- Réaction vers la gauche

Base Acide Conjugué Conjugué


acide basique

f) H2PO4- + H2O ↔ HPO42- + H3O+ Réaction vers la


gauche

Acide Base Conjugué Conjugué


basique acide

g) H2PO4- + H2PO4- ↔ H3PO4 + HPO42- Réaction vers la gauche

Base Acide Conjugué Conjugué


8

acide basique

h) HNO2 + CO32- ↔ NO2- + HCO3- Réaction vers la droite

AcideBase Conjugué Conjugué


basique acide

i) H2CO3 + H2O ↔ HCO3- + H3O+ Réaction vers la


gauche

AcideBase Conjugué Conjugué


basique acide

5.3 a) H3AsO4(aq) ↔ H+(aq) + H2AsO4-(aq) Ka1 = [H+][H2AsO4-]/[H3AsO4]

b) H2AsO4-(aq) ↔ H+(aq) + HAsO42-(aq) Ka2 = [H+][HAsO42-]


/[H2AsO4-]

c) HAsO42-(aq) ↔ H+(aq) + AsO43-(aq) Ka3 = [H+][AsO43-]/[HAsO42-]

d) HNO2(aq) ↔ H+(aq) + NO2-(aq) Ka = [H+][NO2-]/[HNO2]

e) CH3NH3+(aq) ↔ H+(aq) + CH3NH2(aq) Ka =


[H+][CH3NH2]/[CH3NH3+]

f) HCN(aq) ↔ H+(aq) + CN-(aq) Ka = [H+][CN-]/[HCN]

g) CH3CH2CO2H(aq) ↔ H+(aq) + CH3CH2CO2-(aq)

Ka = [H+][CH3CH2CO2-]/[CH3CH2CO2H]

h) C6H5OH(aq) ↔ H+(aq) + C6H5O-(aq) Ka = [H+][C6H5O-]/[C6H5OH]

i) C6H5SO3H(aq) ↔ H+(aq) + C6H5SO3-(aq) Ka = [H+][C6H5SO3-]/[C6H5SO3H]

j) NH2CH2CO2H(aq) ↔ H+(aq) + NH2CH2CO2-(aq)

Ka = [H+][NH2CH2CO2-]/[NH2CH2CO2H]

5.4 a) AsO43-(aq) + H2O(aq) ↔ OH-(aq) + HAsO42-(aq) Kb = [OH-][HAsO42-]


/[AsO43-]

b) HAsO42-(aq) + H2O(aq) ↔ OH-(aq) + H2AsO4-(aq) Kb = [OH-][H2AsO4-]


/[HAsO42-]
9

c) H2AsO4-(aq) + H2O(aq) ↔ OH-(aq) + H3AsO4(aq) Kb = [OH-]


[H3AsO4]/[H2AsO4-]

d) NH3(aq) + H2O(aq) ↔ OH-(aq) + NH4+(aq) Kb = [OH-][NH4+]/[NH3]

e) NO2-(aq) + H2O(aq) ↔ OH-(aq) + HNO2(aq) Kb = [OH-][HNO2]/[NO2-]

f) C5H5N(aq) + H2O(aq) ↔ OH-(aq) + C5H5NH+(aq) Kb = [OH-]


[C5H5NH+]/[C5H5N]

g) NH2CH2CO2H(aq) + H2O(aq) ↔ OH-(aq) + +NH3CH2CO2H(aq)

Kb = [OH-]
[+NH3CH2CO2H]/[NH2CH2CO2H]

h) CH3NH2(aq) + H2O(aq) ↔ OH-(aq) + CH3NH3+(aq) Kb = [OH-]


[CH3NH3+]/[CH3NH2]

i) C6H5NH2(aq) + H2O(aq) ↔ OH-(aq) + C6H5NH3+(aq)

Kb = [OH-][C6H5NH3+]/[C6H5NH2]

j) (CH3)3N + H2O(aq) ↔ OH-(aq) + (CH3)3NH+(aq) Kb = [OH-]


[(CH3)3NH+]/[(CH3)3N]

5.5 a) pH = 2,886

b) pH = 9,60

c) pH = - 0,71

d) pH = 11,54

e) pH = 4,90

f) pH = 14,70

g) pH = 4,49

h) pH = 10,65

5.6 a) [H+] = 3,9 x 10-9 mol/L [OH-] = 2,6 x 10-6 mol/L

b) [H+] = 4,75 x 10-16 mol/L [OH-] = 2,10 x 101 mol/L

c) [H+] = 1,0 x 101 mol/L [OH-] = 1,0 x 10-15 mol/L

d) [OH-] = 6,3 x 10-3 mol/L [H+] = 1,6 x 10-12 mol/L


10

e) [H+] = 9,44 x 10-6 mol/L [OH-] = 1,06 x 10-9 mol/L

f) [OH-] = 2,3 x 10-9 mol/L [H+] = 4,3 x 10-6 mol/L

5.7 a) pH = 0,699

b) pH = 0,699

c) pH = 0,699

d) pH = 3,52

e) pH = 3,00

f) pH = -0,48

5.8 pH = 7,00

5.9 [H+] = 1,920 mol/L

pH = - 0,2833

[OH-] = 5,208 x 10-15 mol/L

5.10 [C6H5CO2H] = 4,08 x 10-3 mol/L

[C6H5CO2-] = 5,1 x 10-4 mol/L

[H+] = 5,1 x 10-4 mol/L pH = 3,29

[OH-] = 1,96 x 10-11 mol/L

5.11 Ka = 0,21 mol/L

5.12 [OH-] = 2,43 x 10-4 mol/L

[H+] = 4,12 x 10-11 mol/L

pH = 10,39

[N2H4] = 1,98 x 10-2 mol/L

[N2H5+] = 2,43 x 10-4 mol/L

5.13 Kb = 5,07 x 10-10 mol/L

5.14 pH = 1,58
11

5.15 [H+] = 9,1 x 10-3 mol/L

[H2PO4-] = 9,1 x 10-3 mol/L

[H3PO4] = 1,1 x 10-2 mol/L

[HPO42-] = 6,30 x 10-8 mol/L

[PO43-] = 2,9 x 10-18 mol/L

[OH-] = 1,1 x 10-12 mol/L


12

5.16
Dissociation du sel pH de la solution
NaBr(aq) → Na+(aq) + Br-(aq) Neutre

Conjugué de Conjugué de
NaOH (base HBr (acide fort)
forte) = neutre = neutre
NaNO3(aq) → Na+(aq) + NO3-(aq) Neutre

Conjugué de Conjugué de
NaOH (base HNO3 (acide
forte) = neutre fort) = neutre
NaNO2(aq) → Na+(aq) + NO2-(aq) Basique

Conjugué de Conjugué de NO2-(aq)+H2O(aq)↔OH-


NaOH (base HNO2 (acide (aq)+HNO2(aq)
forte) = neutre faible) = base
faible
NH4Cl(aq) → NH4+(aq) + Cl-(aq) Acide

Conjugué de Conjugué de NH4+(aq) ↔ H+(aq) + NH3(aq)


NH3 (base HCl (acide fort)
faible) = acide = neutre
faible
NH4NO2(aq) → NH4+(aq) + NO2-(aq) Mélange d'acide et de base faible

Conjugué de Conjugué de NH4+(aq) ↔ H+(aq) + NH3(aq)


NH3 (base HNO2 (acide
NO2-(aq)+H2O(aq) ↔OH-
faible) = acide faible) = base
faible faible (aq)+HNO2(aq)
pH = (pKa1 + pKa2)/2
= (9,26 + 3,40)/2 = 6,33
Acide
NaHCO3(aq) → Na+(aq) + HCO3-(aq) Amphotère

Conjugué de Conjugué de HCO3-(aq) ↔ H+(aq) + CO32-(aq)


NaOH (base H2CO3 (acide
forte) = neutre HCO3-(aq) + H2O(aq) ↔ OH-(aq) +
faible) et de
H2CO3(aq)
CO32- (base
faible)= pH = (pKa1 + pKa2)/2
Amphotère
= (6,37 + 10,25)/2 = 8,31
Basique
13

NH4CH3CO2 NH4+(aq) + CH3CO2-(aq) Mélange d'acide et de base faible



Conjugué de Conjugué de NH4+(aq) ↔ H+(aq) + NH3(aq)
(aq)
NH3 (base CH3CO2H
CH3CO2-(aq) + H2O(aq) ↔ OH-(aq)
faible) = acide (acide faible) =
faible base faible +CH3CO2H(aq)
pH = (pKa1 + pKa2)/2
= (9,26 + 4,74)/2 = 7,00
Neutre
NaCN(aq) → Na+(aq) + CN-(aq) Basique

Conjugué de Conjugué de CN-(aq) + H2O(aq) ↔OH-(aq) +


NaOH (base HCN (acide HCN(aq)
forte) = neutre faible) = base
faible

5.17 a) pH = 5,700

b) pH = 7,87

c) pH = 11,62

d) pH = 7,79

e) pH = 9,994

5.18 CH3CO2- est une base plus faible que OCl-

5.19 a) Les atomes d'oxygène sont très électronégatifs. Ils attirent les électrons et
permettent à l'atome d'hydrogène de se libérer sous forme de H+. Plus il y a
d'atomes d'oxygène, plus un oxoacide est fort.

b) Un polyacide libère un premier proton, puis un deuxième, etc... La première


constante d'acidité est donc plus grande que la deuxième, etc...

5.20 a) BaO Basique d) Cl2O Acide

b) Cs2O Basique e) P2O5 Acide

c) SO3 Acide f) N2O 5 Acide

5.21 pH = 7,38

5.22 Le pouvoir tampon d'une solution c'est sa capacité à conserver son pH lorsqu'on lui
ajoute des acides ou des bases.

Les solutions contenant un acide faible (concentration Ca mol/L) et son conjugué


basique (concentration Cb mol/L) ont un bon pouvoir tampon.
14

Plus une solution est concentrée (Ca et Cb grands) plus son pouvoir tampon est bon.

pH d'un tampon = pKa + log [Cb/Ca] si Ca = Cb ; pH = pKa

CH3CO2H (0,01 mol/L)/CH3CO2- (0,01 mol/L) pH = pKa = 4,74

CH3CO2H (0,1 mol/L)/CH3CO2Na (0,1 mol/L) pH = pKa = 4,74

CH3CO2H (1,0 mol/L)/CH3CO2Na (1,0 mol/L) pH = pKa = 4,74

La dernière solution a un meilleur pouvoir tampon car elle est plus concentrée.

5.23 a) pH = 2,79

b) pH = 9,09

c) pH = 7,00

d) pH = 4,89

5.24 a) pH = 1,40

b) pH = 5,49

c) pH = 1,40

d) pH = 4,71

5.25 a) pH = 4,28

b) pH = 12,60

c) pH = 12,60

d) pH = 5,06

Comparaison des pH
15

pH pH après ∆pH pH après ∆pH


addition de addition de
HCl NaOH
CH3CH2CO2H 2,79 1,40 -1,39 4,28 1,49

CH3CH2CO2- 9,09 5,49 -3,60 12,60 3,51

H 2O 7,00 1,40 -5,60 12,60 5,60

CH3CH2CO2H 4,89 4,71 -0,18 5,06 0,17


+
CH3CH2CO2-

Le pH varie très peu (- 0,18 ou + 0,17) quand on ajoute un acide fort (HCl) ou
une base forte (NaOH) à une solution tampon (CH3CH2CO2H + CH3CH2CO2-).

Le pH varie un peu plus (-1,39 ou +1,49) quand on ajoute un acide fort (HCl) ou
une base forte (NaOH) à une solution d'acide faible (CH3CH2CO2H).

Le pH varie beaucoup (-3,60 ou +3,51) quand on ajoute un acide fort (HCl) ou


une base forte (NaOH) à une solution d'une base très faible (CH3CH2CO2-).

Le pH varie encore plus (± 5,60) quand on ajoute un acide fort (HCl) ou une base
forte (NaOH) à une solution neutre (H2O).

5.26 a) 40,0 g

b) 9,79 g

c) 55,0 g

5.27 0,0 mL pH = 2,43

24,0 mL pH = 5,23

24,9 mL pH = 6,25

25,0 mL pH = 8,27

25,1 mL pH = 10,30

26,0 mL pH = 11,29

Indicateur : bleu de thymol [7,2 - 9,0] ou phénolphthaléine [8,0 - 9,5]. Les zones de
virage des deux indicateurs se situent complètement à l'intérieur de l'intervalle de pH
[6,25 - 10,30] et les deux indicateurs changeront de couleur dans l'intervalle de
volume [24,9 mL - 25,1 mL]. L'incertitude du volume mesuré sera inférieur à ± 0,1 mL
(± 0,4 %). La précision sera d'au moins 99,6%.

5.28 0,0 mL pH = 11,12

24,0 mL pH = 7,88
16

24,9 mL pH = 6,86

25,0 mL pH = 5,28

25,1 mL pH = 3,70

26,0 mL pH = 2,70

Indicateur : vert de bromocrésol [3.5 - 5,3]. La zone de virage de l'indicateur ne se


situe pas complètement à l'intérieur de l'intervalle de pH [3,70 - 6,86] et l'indicateur
ne changera pas nécessairement de couleur dans l'intervalle de volume [24,9 mL -
25,1 mL]. L'incertitude du volume mesuré sera supérieur à ± 0,1 mL (± 0,4 %). La
précision sera moins grande que 99,6%. Par contre la zone de virage de l'indicateur se
situe complètement à l'intérieur de l'intervalle de pH [2,70 - 7,88] et l'indicateur
changera de couleur dans l'intervalle de volume [24,0 mL - 25,0 mL]. L'incertitude du
volume mesuré sera inférieur à ± 1 mL (± 4 %). La précision sera plus grande que 96
%.

5.29 0,0 mL pH = 13,000

24,0 mL pH = 11,31

24,9 mL pH = 10,30

25,0 mL pH = 7,000

25,1 mL pH = 3,70

26,0 mL pH = 2,70

Indicateur : bleu de bromothymol [5,8 - 7,4]. La zone de virage de l'indicateur se situe


complètement à l'intérieur de l'intervalle de pH [3,70 - 10,30] et l'indicateur changera
de couleur dans l'intervalle de volume [24,9 mL - 25,1 mL]. L'incertitude du volume
mesuré sera inférieur à ± 0,1 mL (± 0,4 %). La précision sera plus grande que 99,6%.
Les zones de virage d'autres indicateurs comme le bleu de thymol et la
phénolphthaléine se situent complètement à l'intérieur de l'intervalle de pH [3,70 -
10,30] et ces indicateurs permettront aussi une précision supérieure à 99,6%.
17

6. Équilibres ioniques

6.1 a) BaC2O4 Kps = 5,8 x 10-10 (mol/L)2

b) PbI2 Kps = 6,24 x 10-6 (mol/L)3

c) BiBr3 Kps = 4,10 x 10-19 (mol/L)4

d) MnC2O4 Kps = 1,53 x 10-7 (mol/L)2

e) Fe(IO4)2 Kps = 7,05 x 10-7 (mol/L)3

f) Tl2CO3 Kps = 3,52 x 10-6 (mol/L)3

6.2 a) Al(OH)3 s = 1,5 x 10-9 mol/L = 1,2 x 10-7 g/L

b) BaSO4 s = 3,9 x 10-5 mol/L = 9,1 x 10-3 g/L

c) Hg2Cl2 s = 6,3 x 10-7 mol/L = 3,0 x 10-4 g/L

d) Ag2CrO4 s = 8,4 x 10-5 mol/L = 2,8 x 10-2 g/L

e) Ag2S s = 2,6 x 10-17 mol/L = 6,4 x 10-15 g/L

6.3 a) s = 3,4 x 10-5 mol/L

b) s = 1,6 x 10-5 mol/L

6.4 a) s = 1,5 x 10-3 mol/L

b) s = 5,9 x 10-4 mol/L

c) s = 1,4 x 10-4 mol/L

6.5 a) à pH 1 : CuS et HgS précipitent

b) à pH 10,0 : CuS, NiS, MnS et HgS précipitent

6.6 [Pb2+] = 0,0080 mol/L [Cl-] = 0,0080 mol/L

[K+] = 0,0080 mol/L [NO3-] = 0,016 mol/L


18

7. Oxydoréduction

7.1 a) K2Cr2O7 DK = +1 DO = -2 DCr = +6

b) MnO2 DO = -2 DMn = +4

c) K3Fe(CN)6 DK = +1 DFe = +3 DN = -3 DC = +2

d) (NH4)2HPO4 DO = -2 DH = +1 DP = +5 DN = -3

e) LiAlH4 DLi = +1 DAl = +3 DH = -1

f) Fe2O3 DO = -2 DFe = +3

g) SeOF4 DF = -1 DO = -2 DSe = +6

h) SF4 DF = -1 DS = +4

i) Na2O2 DNa = +1 DO = -1

j) K2C2O4 DK = +1 DO = -2 DC = +3

7.2

Équation globale Oxydant Réducteur Atome oxydé Atome réduit


2C2H6 + 7O2→ 4CO2 + O2 C2H6 C O
6H2O

Fe + 2HCl → FeCl2 + H2 HCl Fe Fe H

Cr2O72-+2OH-→2CrO42- Aucun Aucun


+H2O

O3 + CO → O2 + CO2 O3 CO C O

2H2O2 → 2H2O + O2 H 2 O2 H2O2 O O

2CuCl → CuCl2 + Cu CuCl CuCl Cu Cu

HNO3 + NH3 → NH4NO3 Aucun Aucun

7.3 a) 4 Mg(s) + H3AsO4(aq) + 8 H+(aq) → 4 Mg2+(aq) + AsH3(g) + 4 H2O(aq)

b) 10 I-(aq) + 2 MnO4-(aq) + 16 H+(aq) → 5 I2(l) + 2Mn2+(aq) + 8 H2O(aq)

c) 6 Cl-(aq) + Cr2O72-(aq) + 14H+(aq) → 3 Cl2(l) + 2Cr3+(aq) + 7 H2O(aq)


19

d) Pb(s) + PbO2(s) + 2H2SO4(aq) →2PbSO4(s) + 2H2O(aq)

e) 2 Mn2+(aq) + 5 NaBiO3(s) + 14 H+(aq) → 2 MnO4-(aq) + 5 Bi3+(aq) + 5 Na+(aq) +


7 H2O(aq)

f) 8 I-(aq) + IO3-(aq) + 6H+(aq) → 3 I3-(aq) + 3H2O(aq)

g) 3 Sb2O3(s) + 7 H2O(aq) + 4 NO3-(aq) + 4 H+(aq) → 6H3SbO4(aq) + 4 NO(g)

h) 3 Cu(s) + 2HNO3(aq) + 6H+(aq) → 3 Cu2+(aq) + 2NO(g) + 4 H2O(aq)

7.4 a) 3 Zn(s) + OH-(aq) + 2 MnO4-(aq) + 4 H2O(aq) → 3Zn(OH)3-(aq) + 2 MnO2(s)

b) 2 CrBr3(s) + 64 OH-(aq) + 27 Cl2(g) → 2 CrO42-(aq) + 6 BrO4-(aq) + 32 H 2O(aq) +


54 Cl-(aq)

c) 2 Br2(g) + 4 OH-(aq) → 2 BrO-(aq) + 2 H2O(aq) + 2 Br-(aq)

d) 8 Al(s) + 5 OH-(aq) + 3 NO3-(aq) + 2 H2O(aq) → 8AlO2-(aq) + 3 NH3(g)

e) 3 S2-(aq) + 2 MnO4-(aq) + 4 H2O(aq) → 3 S(s) + 2MnO2(s) + 8 OH-(aq)

f) 2 Fe(OH)2(s) + H2O2(aq) → 2 Fe(OH)3(s)

g) 3 CN-(aq) + H2O(aq) + 2 MnO4-(aq) → 3 CNO-(aq) + 2MnO2(s) + 2 OH-(aq)

7.5 C(MnO4-) = 0,02835 mol/L

5 H2C2O4(aq) + 2 MnO4-(aq) + 6 H+(aq) → 10 CO2(aq) + 2 Mn2+(aq) + 8 H2O(aq)

7.6 C(Fe2+) = 0,0599 mol/L

6 Fe2+(aq) + Cr2O72-(aq) + 14H+(aq) → 6 Fe3+(aq) + 2Cr3+(aq) + 7 H2O(aq)

7.7 a) La loi canadienne est respectée car 0,06934 % < 0,08 %

b) La loi canadienne n'est pas respectée car 0,1135 % > 0,08 %

7.8 a) Eélectrode = 0,32 volt ∆E = 0,07 volt Anode : Électrode de calomel

b) Eélectrode = 0,63 volt ∆E = 0,38 volt Anode : Électrode de calomel

c) Eélectrode = 0,46 volt ∆E = 0,21 volt Anode : Électrode de calomel

d) Eélectrode = 1,23 volt ∆E = 0,98 volt Anode : Électrode de calomel

e) Eélectrode = 0,30 volt ∆E = 0,05 volt Anode : Électrode de calomel


20

7.9 a) Réaction impossible

b) Réaction impossible

c) Réaction possible

d) Réaction possible

e) Réaction impossible
21

EXERCICES DE REVISION

CHAPITRE 1 LES SOLUTIONS

1. a) 37,4%P/P b) 25,6 mL H2O c) 0,110 d) insaturée

2. a) xH2O=0,900 et xCH3COCH3=0,100 b) yH2O=0,497 et yCH3COCH3=0,503

c) La pression de vapeur selon la loi de Raoult serait plus grande que celle mesurée.

o -1
3. a) 128 g/mol b) naphtalène c) 19,3 C kg mol

CHAPITRE 6 CINÉTIQUE CHIMIQUE

-3 -1
1. a) 2,60x10 mol/L min

-2 -1 -2 -1
b) 1,30 x10 min avec 0,200 mol/L et 1,39x10 min avec 0,187 mol/L

-1
c) 0,014 min

d) 49,5 min

e) 57%

1
2. a) v=k[O2] [NO]2

b) ordre global=3

c) Oui, car les coefficients stoechiométriques correspondent aux ordres partiels.

-2 -1
d) (mol/L) t

CHAPITRE 2 LES ÉQUILIBRES CHIMIQUES

-9
1 1,1x10 Pa-2

2 a) amélioré, équilibre à droite b) amélioré, équilibre à droite

c) non changé, C solide d) amélioré, équilibre à droite e) non changé

3. Kc = 4,33 x 10-8 (mol/L)3

3
4. [CO]é=[H2O]é=[CO2]é=[H2]é=0,250 mol/m

CHAPITRE 4- ACIDES ET BASES


22

1. a) [Cl3CCOOH]= 0,03 mol/L, [H3O+]=[Cl3CCOO-]= 0,073 mol/L, [OH-] = 1,4 x10-13


mol/L

b) [HNO2]=0,48 mol/L, [NO2-]=[H3O+]=1,7 x10-2 mol/L, [OH-]= 5,9 x10-13 mol/L

c) [(CH3)3N]= 0,33 mol/L, [(CH3)3NH+]=[OH-]= 5,1 x10-3 mol/L, [H3O+]= 2,0 x10-12
mol/L

2. pH = 9,59

3. KA= 3,5 x10-4 mol/L

4. a) [NH3]= 0,083 mol/L, [NH4+]=[Cl-]= 0,10 mol/L=[OH-], [H3O+]= 6,7 x10-10 mol/L

b) pH = 9,17 c) pH = 9,17

5. a) HCl + Na+NO2- → HNO2 + Na+ + Cl-

b) K très grande donc réaction complète. c) VHCl= 36,5 mL

6. a) VNaOH=37,7 mL, pH=7

b) VNaOH=27,3 mL, pH basique mais ne peut être calculé avec exactitude


facilement car [OH-]eau ne peut être négligée.

7. a) 0,168 mol/L

b) KA= 10-4 mol/L

c) rouge de phénol et thymolphtaléine